C23H32N6O3 — CID 71151137
(2S,3R,5R)-5-[6-amino-2-[3-(4-ethylcyclohexyl)prop-1-ynyl]purin-9-yl]-N-ethyl-3-hydroxyoxolane-2-carboxamide (PubChem CID 71151137) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is (2S,3R,5R)-5-[6-amino-2-[3-(4-ethylcyclohexyl)prop-1-ynyl]purin-9-yl]-N-ethyl-3-hydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3R,5R)-5-[6-amino-2-[3-(4-ethylcyclohexyl)prop-1-ynyl]purin-9-yl]-N-ethyl-3-hydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 71151137 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | (2S,3R,5R)-5-[6-amino-2-[3-(4-ethylcyclohexyl)prop-1-ynyl]purin-9-yl]-N-ethyl-3-hydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#CCC4CCC(CC)CC4)nc32)C[C@H]1O |
| InChI | InChI=1S/C23H32N6O3/c1-3-14-8-10-15(11-9-14)6-5-7-17-27-21(24)19-22(28-17)29(13-26-19)18-12-16(30)20(32-18)23(31)25-4-2/h13-16,18,20,30H,3-4,6,8-12H2,1-2H3,(H,25,31)(H2,24,27,28)/t14?,15?,16-,18-,20+/m1/s1 |
| InChIKey | PVSDSMRCAVRSCG-KHGIWVOMSA-N |
| XLogP | 2.15 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|