C16H22F3N5O2S2 — CID 153333045
[5-[6-(2-methylsulfanylethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]oxolan-2-yl]methanol (PubChem CID 153333045) has the molecular formula C16H22F3N5O2S2 and a molecular weight of 437.51 g/mol. Its IUPAC name is [5-[6-(2-methylsulfanylethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]oxolan-2-yl]methanol.
| Compound Name | [5-[6-(2-methylsulfanylethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 153333045 |
| Molecular Formula | C16H22F3N5O2S2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | [5-[6-(2-methylsulfanylethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]oxolan-2-yl]methanol |
| SMILES | CSCCNc1nc(SCCC(F)(F)F)nc2c1ncn2C1CCC(CO)O1 |
| InChI | InChI=1S/C16H22F3N5O2S2/c1-27-7-5-20-13-12-14(23-15(22-13)28-6-4-16(17,18)19)24(9-21-12)11-3-2-10(8-25)26-11/h9-11,25H,2-8H2,1H3,(H,20,22,23) |
| InChIKey | TUUJUDCCKPBKNV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|