C16H22F3N5OS2 — CID 145305524
9-(5-methyloxolan-2-yl)-N-(2-methylsulfanylethyl)-2-(3,3,3-trifluoropropylsulfanyl)purin-6-amine (PubChem CID 145305524) has the molecular formula C16H22F3N5OS2 and a molecular weight of 421.51 g/mol. Its IUPAC name is 9-(5-methyloxolan-2-yl)-N-(2-methylsulfanylethyl)-2-(3,3,3-trifluoropropylsulfanyl)purin-6-amine.
| Compound Name | 9-(5-methyloxolan-2-yl)-N-(2-methylsulfanylethyl)-2-(3,3,3-trifluoropropylsulfanyl)purin-6-amine |
|---|---|
| PubChem CID | 145305524 |
| Molecular Formula | C16H22F3N5OS2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 9-(5-methyloxolan-2-yl)-N-(2-methylsulfanylethyl)-2-(3,3,3-trifluoropropylsulfanyl)purin-6-amine |
| SMILES | CSCCNc1nc(SCCC(F)(F)F)nc2c1ncn2C1CCC(C)O1 |
| InChI | InChI=1S/C16H22F3N5OS2/c1-10-3-4-11(25-10)24-9-21-12-13(20-6-8-26-2)22-15(23-14(12)24)27-7-5-16(17,18)19/h9-11H,3-8H2,1-2H3,(H,20,22,23) |
| InChIKey | IWXXVDHEJNCHNH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|