C31H43N7O7S — CID 91418854
[9-[(2R,3S,5R)-3-(2-cyanoethoxy)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(dimethylaminomethylideneamino)purin-6-yl] 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 91418854) has the molecular formula C31H43N7O7S and a molecular weight of 657.79 g/mol. Its IUPAC name is [9-[(2R,3S,5R)-3-(2-cyanoethoxy)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(dimethylaminomethylideneamino)purin-6-yl] 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | [9-[(2R,3S,5R)-3-(2-cyanoethoxy)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(dimethylaminomethylideneamino)purin-6-yl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 91418854 |
| Molecular Formula | C31H43N7O7S |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | [9-[(2R,3S,5R)-3-(2-cyanoethoxy)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(dimethylaminomethylideneamino)purin-6-yl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)Oc2nc(N=CN(C)C)nc3c2ncn3[C@@H]2O[C@H](CO)C(O)[C@@H]2OCCC#N)c(C(C)C)c1 |
| InChI | InChI=1S/C31H43N7O7S/c1-17(2)20-12-21(18(3)4)27(22(13-20)19(5)6)46(41,42)45-29-24-28(35-31(36-29)34-15-37(7)8)38(16-33-24)30-26(43-11-9-10-32)25(40)23(14-39)44-30/h12-13,15-19,23,25-26,30,39-40H,9,11,14H2,1-8H3/t23-,25?,26+,30-/m1/s1 |
| InChIKey | MLWJCMMZKNSLQG-MAMYHSDDSA-N |
| XLogP | 3.74 |
| TPSA | 185.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|