C25H32FN7O6 — CID 135474791
N'-[9-[(2R,3R,4R,5R)-3-[1-(2-fluorophenyl)-4-methoxypiperidin-4-yl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 135474791) has the molecular formula C25H32FN7O6 and a molecular weight of 545.57 g/mol. Its IUPAC name is N'-[9-[(2R,3R,4R,5R)-3-[1-(2-fluorophenyl)-4-methoxypiperidin-4-yl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(2R,3R,4R,5R)-3-[1-(2-fluorophenyl)-4-methoxypiperidin-4-yl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 135474791 |
| Molecular Formula | C25H32FN7O6 |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | N'-[9-[(2R,3R,4R,5R)-3-[1-(2-fluorophenyl)-4-methoxypiperidin-4-yl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | COC1(O[C@@H]2[C@H](O)[C@@H](CO)O[C@H]2n2cnc3c(=O)[nH]c(/N=C/N(C)C)nc32)CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H32FN7O6/c1-31(2)13-28-24-29-21-18(22(36)30-24)27-14-33(21)23-20(19(35)17(12-34)38-23)39-25(37-3)8-10-32(11-9-25)16-7-5-4-6-15(16)26/h4-7,13-14,17,19-20,23,34-35H,8-12H2,1-3H3,(H,29,30,36)/b28-13+/t17-,19-,20-,23-/m1/s1 |
| InChIKey | KIAFMNRWXXALAU-FJAGQYRASA-N |
| XLogP | 0.76 |
| TPSA | 150.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|