C17H18N6O6 — CID 162001493
9-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(2-hydroxy-4-methylphenyl)diazenyl]-1H-purin-6-one (PubChem CID 162001493) has the molecular formula C17H18N6O6 and a molecular weight of 402.37 g/mol. Its IUPAC name is 9-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(2-hydroxy-4-methylphenyl)diazenyl]-1H-purin-6-one.
| Compound Name | 9-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(2-hydroxy-4-methylphenyl)diazenyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 162001493 |
| Molecular Formula | C17H18N6O6 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 9-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(2-hydroxy-4-methylphenyl)diazenyl]-1H-purin-6-one |
| SMILES | Cc1ccc(/N=N/c2nc3c(ncn3C3O[C@H](CO)[C@@H](O)[C@H]3O)c(=O)[nH]2)c(O)c1 |
| InChI | InChI=1S/C17H18N6O6/c1-7-2-3-8(9(25)4-7)21-22-17-19-14-11(15(28)20-17)18-6-23(14)16-13(27)12(26)10(5-24)29-16/h2-4,6,10,12-13,16,24-27H,5H2,1H3,(H,19,20,28)/b22-21+/t10-,12-,13-,16?/m1/s1 |
| InChIKey | XOKUQYCMYNTLHC-SJTSZTQHSA-N |
| XLogP | 0.16 |
| TPSA | 178.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|