C16H22ClN9O6 — CID 168664935
1-(2-chloroethyl)-3-[2-[2-(dimethylaminomethylideneamino)-6-oxo-1H-purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-1-nitrosourea (PubChem CID 168664935) has the molecular formula C16H22ClN9O6 and a molecular weight of 471.86 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[2-[2-(dimethylaminomethylideneamino)-6-oxo-1H-purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-1-nitrosourea.
| Compound Name | 1-(2-chloroethyl)-3-[2-[2-(dimethylaminomethylideneamino)-6-oxo-1H-purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-1-nitrosourea |
|---|---|
| PubChem CID | 168664935 |
| Molecular Formula | C16H22ClN9O6 |
| Molecular Weight | 471.86 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 1-(2-chloroethyl)-3-[2-[2-(dimethylaminomethylideneamino)-6-oxo-1H-purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-1-nitrosourea |
| SMILES | CN(C)C=Nc1nc2c(ncn2C2OC(CO)C(O)C2NC(=O)N(CCCl)N=O)c(=O)[nH]1 |
| InChI | InChI=1S/C16H22ClN9O6/c1-24(2)6-19-15-21-12-10(13(29)22-15)18-7-25(12)14-9(11(28)8(5-27)32-14)20-16(30)26(23-31)4-3-17/h6-9,11,14,27-28H,3-5H2,1-2H3,(H,20,30)(H,21,22,29) |
| InChIKey | XLFYVDZNZRHNGP-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 190.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.86 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|