C39H38N6O5 — CID 10842174
N,N-dibenzyl-N'-[1-benzyl-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-phenylmethoxyoxolan-2-yl]-6-oxopurin-2-yl]methanimidamide (PubChem CID 10842174) has the molecular formula C39H38N6O5 and a molecular weight of 670.77 g/mol. Its IUPAC name is N,N-dibenzyl-N'-[1-benzyl-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-phenylmethoxyoxolan-2-yl]-6-oxopurin-2-yl]methanimidamide.
| Compound Name | N,N-dibenzyl-N'-[1-benzyl-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-phenylmethoxyoxolan-2-yl]-6-oxopurin-2-yl]methanimidamide |
|---|---|
| PubChem CID | 10842174 |
| Molecular Formula | C39H38N6O5 |
| Molecular Weight | 670.77 g/mol |
| Exact Mass | 670.29 |
| IUPAC Name | N,N-dibenzyl-N'-[1-benzyl-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-phenylmethoxyoxolan-2-yl]-6-oxopurin-2-yl]methanimidamide |
| SMILES | O=c1c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3OCc3ccccc3)c2nc(/N=C/N(Cc2ccccc2)Cc2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C39H38N6O5/c46-24-32-34(47)35(49-25-31-19-11-4-12-20-31)38(50-32)45-27-40-33-36(45)42-39(44(37(33)48)23-30-17-9-3-10-18-30)41-26-43(21-28-13-5-1-6-14-28)22-29-15-7-2-8-16-29/h1-20,26-27,32,34-35,38,46-47H,21-25H2/b41-26+/t32-,34-,35-,38-/m1/s1 |
| InChIKey | CTRHOETYWHYRNP-GUVLTGFPSA-N |
| XLogP | 4.84 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|