C33H31N5O6 — CID 101091040
5,7-dibenzyl-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(4-methoxyphenyl)imidazo[1,2-a]purin-9-one (PubChem CID 101091040) has the molecular formula C33H31N5O6 and a molecular weight of 593.64 g/mol. Its IUPAC name is 5,7-dibenzyl-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(4-methoxyphenyl)imidazo[1,2-a]purin-9-one.
| Compound Name | 5,7-dibenzyl-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(4-methoxyphenyl)imidazo[1,2-a]purin-9-one |
|---|---|
| PubChem CID | 101091040 |
| Molecular Formula | C33H31N5O6 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | 5,7-dibenzyl-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(4-methoxyphenyl)imidazo[1,2-a]purin-9-one |
| SMILES | COc1ccc(-c2c(Cc3ccccc3)n3c(=O)c4ncn([C@@H]5O[C@H](CO)[C@@H](O)[C@H]5O)c4nc3n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H31N5O6/c1-43-23-14-12-22(13-15-23)27-24(16-20-8-4-2-5-9-20)38-31(42)26-30(35-33(38)36(27)17-21-10-6-3-7-11-21)37(19-34-26)32-29(41)28(40)25(18-39)44-32/h2-15,19,25,28-29,32,39-41H,16-18H2,1H3/t25-,28-,29-,32-/m1/s1 |
| InChIKey | OVEZQMFEVMQMFW-FANUBLADSA-N |
| XLogP | 2.77 |
| TPSA | 136.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |