C12H17Hg2N4O5 — CID 5257418
[9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxopurin-1-yl]-methylmercury;methylmercury (PubChem CID 5257418) has the molecular formula C12H17Hg2N4O5 and a molecular weight of 698.47 g/mol. Its IUPAC name is [9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxopurin-1-yl]-methylmercury;methylmercury.
| Compound Name | [9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxopurin-1-yl]-methylmercury;methylmercury |
|---|---|
| PubChem CID | 5257418 |
| Molecular Formula | C12H17Hg2N4O5 |
| Molecular Weight | 698.47 g/mol |
| Exact Mass | 701.06 |
| IUPAC Name | [9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxopurin-1-yl]-methylmercury;methylmercury |
| SMILES | C[Hg].C[Hg]n1cnc2c(ncn2C2OC(CO)C(O)C2O)c1=O |
| InChI | InChI=1S/C10H12N4O5.2CH3.2Hg/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18;;;;/h2-4,6-7,10,15-17H,1H2,(H,11,12,18);2*1H3;;/q;;;;+1/p-1 |
| InChIKey | PIEWLIHVIHVWRD-UHFFFAOYSA-M |
| XLogP | -1.32 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.47 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|