C33H51N5O7SSi — CID 45258605
[9-[(4aR,6R,7R,7aS)-2,2-ditert-butyl-7-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]-2-aminopurin-6-yl] 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 45258605) has the molecular formula C33H51N5O7SSi and a molecular weight of 689.95 g/mol. Its IUPAC name is [9-[(4aR,6R,7R,7aS)-2,2-ditert-butyl-7-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]-2-aminopurin-6-yl] 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | [9-[(4aR,6R,7R,7aS)-2,2-ditert-butyl-7-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]-2-aminopurin-6-yl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 45258605 |
| Molecular Formula | C33H51N5O7SSi |
| Molecular Weight | 689.95 g/mol |
| Exact Mass | 689.33 |
| IUPAC Name | [9-[(4aR,6R,7R,7aS)-2,2-ditert-butyl-7-hydroxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]-2-aminopurin-6-yl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)Oc2nc(N)nc3c2ncn3[C@@H]2O[C@@H]3CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]3[C@H]2O)c(C(C)C)c1 |
| InChI | InChI=1S/C33H51N5O7SSi/c1-17(2)20-13-21(18(3)4)27(22(14-20)19(5)6)46(40,41)44-29-24-28(36-31(34)37-29)38(16-35-24)30-25(39)26-23(43-30)15-42-47(45-26,32(7,8)9)33(10,11)12/h13-14,16-19,23,25-26,30,39H,15H2,1-12H3,(H2,34,36,37)/t23-,25-,26-,30-/m1/s1 |
| InChIKey | GKRGFAFHBIIZNX-NYBSAPDNSA-N |
| XLogP | 6.26 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.95 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|