C24H26FN4O13P3 — CID 57332120
[[(2R,3S,5R)-5-[4-amino-5-[2-fluoro-4-(4-methoxyphenyl)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 57332120) has the molecular formula C24H26FN4O13P3 and a molecular weight of 690.41 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-[4-amino-5-[2-fluoro-4-(4-methoxyphenyl)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-[4-amino-5-[2-fluoro-4-(4-methoxyphenyl)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 57332120 |
| Molecular Formula | C24H26FN4O13P3 |
| Molecular Weight | 690.41 g/mol |
| Exact Mass | 690.07 |
| IUPAC Name | [[(2R,3S,5R)-5-[4-amino-5-[2-fluoro-4-(4-methoxyphenyl)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | COc1ccc(-c2ccc(-c3cn([C@H]4C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O4)c4ncnc(N)c34)c(F)c2)cc1 |
| InChI | InChI=1S/C24H26FN4O13P3/c1-38-15-5-2-13(3-6-15)14-4-7-16(18(25)8-14)17-10-29(24-22(17)23(26)27-12-28-24)21-9-19(30)20(40-21)11-39-44(34,35)42-45(36,37)41-43(31,32)33/h2-8,10,12,19-21,30H,9,11H2,1H3,(H,34,35)(H,36,37)(H2,26,27,28)(H2,31,32,33)/t19-,20+,21+/m0/s1 |
| InChIKey | YMXUOKHJFUIQGF-PWRODBHTSA-N |
| XLogP | 3.49 |
| TPSA | 255.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|