C23H33N4O3PS — CID 177175795
[[(2S,5R)-5-(4-amino-5-octa-1,7-diynyl-2-oxopyrimidin-1-yl)oxolan-2-yl]methylamino]phosphinothious acid;hex-5-yn-1-ol (PubChem CID 177175795) has the molecular formula C23H33N4O3PS and a molecular weight of 476.58 g/mol. Its IUPAC name is [[(2S,5R)-5-(4-amino-5-octa-1,7-diynyl-2-oxopyrimidin-1-yl)oxolan-2-yl]methylamino]phosphinothious acid;hex-5-yn-1-ol.
| Compound Name | [[(2S,5R)-5-(4-amino-5-octa-1,7-diynyl-2-oxopyrimidin-1-yl)oxolan-2-yl]methylamino]phosphinothious acid;hex-5-yn-1-ol |
|---|---|
| PubChem CID | 177175795 |
| Molecular Formula | C23H33N4O3PS |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | [[(2S,5R)-5-(4-amino-5-octa-1,7-diynyl-2-oxopyrimidin-1-yl)oxolan-2-yl]methylamino]phosphinothious acid;hex-5-yn-1-ol |
| SMILES | C#CCCCCC#Cc1cn([C@H]2CC[C@@H](CNPS)O2)c(=O)nc1N.C#CCCCCO |
| InChI | InChI=1S/C17H23N4O2PS.C6H10O/c1-2-3-4-5-6-7-8-13-12-21(17(22)20-16(13)18)15-10-9-14(23-15)11-19-24-25;1-2-3-4-5-6-7/h1,12,14-15,19,24-25H,3-6,9-11H2,(H2,18,20,22);1,7H,3-6H2/t14-,15+;/m0./s1 |
| InChIKey | FLIWGBILXSWVHX-LDXVYITESA-N |
| XLogP | 2.86 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|