C10H14BrN3O3 — CID 139418545
4-amino-5-bromo-1-[5-(2-hydroxyethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 139418545) has the molecular formula C10H14BrN3O3 and a molecular weight of 304.14 g/mol. Its IUPAC name is 4-amino-5-bromo-1-[5-(2-hydroxyethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-5-bromo-1-[5-(2-hydroxyethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 139418545 |
| Molecular Formula | C10H14BrN3O3 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 4-amino-5-bromo-1-[5-(2-hydroxyethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1nc(=O)n(C2CCC(CCO)O2)cc1Br |
| InChI | InChI=1S/C10H14BrN3O3/c11-7-5-14(10(16)13-9(7)12)8-2-1-6(17-8)3-4-15/h5-6,8,15H,1-4H2,(H2,12,13,16) |
| InChIKey | XLYGBICNKSVAGG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |