C11H17N3O4 — CID 139418555
4-amino-1-[5-(2-hydroxyethyl)oxolan-2-yl]-5-(hydroxymethyl)pyrimidin-2-one (PubChem CID 139418555) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-amino-1-[5-(2-hydroxyethyl)oxolan-2-yl]-5-(hydroxymethyl)pyrimidin-2-one.
| Compound Name | 4-amino-1-[5-(2-hydroxyethyl)oxolan-2-yl]-5-(hydroxymethyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 139418555 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 4-amino-1-[5-(2-hydroxyethyl)oxolan-2-yl]-5-(hydroxymethyl)pyrimidin-2-one |
| SMILES | Nc1nc(=O)n(C2CCC(CCO)O2)cc1CO |
| InChI | InChI=1S/C11H17N3O4/c12-10-7(6-16)5-14(11(17)13-10)9-2-1-8(18-9)3-4-15/h5,8-9,15-16H,1-4,6H2,(H2,12,13,17) |
| InChIKey | HXGLZNIBWJSLRJ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |