C11H17N4O3Tl — CID 153392821
[5-[4-amino-5-(2-aminoethyl)-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxythallium (PubChem CID 153392821) has the molecular formula C11H17N4O3Tl and a molecular weight of 457.67 g/mol. Its IUPAC name is [5-[4-amino-5-(2-aminoethyl)-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxythallium.
| Compound Name | [5-[4-amino-5-(2-aminoethyl)-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxythallium |
|---|---|
| PubChem CID | 153392821 |
| Molecular Formula | C11H17N4O3Tl |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | [5-[4-amino-5-(2-aminoethyl)-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxythallium |
| SMILES | NCCc1cn(C2CCC(CO[Tl])O2)c(=O)nc1N |
| InChI | InChI=1S/C11H17N4O3.Tl/c12-4-3-7-5-15(11(17)14-10(7)13)9-2-1-8(6-16)18-9;/h5,8-9H,1-4,6,12H2,(H2,13,14,17);/q-1;+1 |
| InChIKey | LECYOINAOSVGPR-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |