C14H20FN3O4 — CID 178041271
[5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl 3-methylbutanoate (PubChem CID 178041271) has the molecular formula C14H20FN3O4 and a molecular weight of 313.33 g/mol. Its IUPAC name is [5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl 3-methylbutanoate.
| Compound Name | [5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl 3-methylbutanoate |
|---|---|
| PubChem CID | 178041271 |
| Molecular Formula | C14H20FN3O4 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | [5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OCC1CCC(n2cc(F)c(N)nc2=O)O1 |
| InChI | InChI=1S/C14H20FN3O4/c1-8(2)5-12(19)21-7-9-3-4-11(22-9)18-6-10(15)13(16)17-14(18)20/h6,8-9,11H,3-5,7H2,1-2H3,(H2,16,17,20) |
| InChIKey | WAHZSCCBDOLTDZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |