C21H33N3O7Si — CID 101171819
[(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[2-oxo-4-(prop-2-enoxycarbonylamino)pyrimidin-1-yl]oxolan-3-yl] acetate (PubChem CID 101171819) has the molecular formula C21H33N3O7Si and a molecular weight of 467.60 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[2-oxo-4-(prop-2-enoxycarbonylamino)pyrimidin-1-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[2-oxo-4-(prop-2-enoxycarbonylamino)pyrimidin-1-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 101171819 |
| Molecular Formula | C21H33N3O7Si |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | [(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[2-oxo-4-(prop-2-enoxycarbonylamino)pyrimidin-1-yl]oxolan-3-yl] acetate |
| SMILES | C=CCOC(=O)Nc1ccn([C@H]2C[C@H](OC(C)=O)[C@@H](CO[Si](C)(C)C(C)(C)C)O2)c(=O)n1 |
| InChI | InChI=1S/C21H33N3O7Si/c1-8-11-28-20(27)23-17-9-10-24(19(26)22-17)18-12-15(30-14(2)25)16(31-18)13-29-32(6,7)21(3,4)5/h8-10,15-16,18H,1,11-13H2,2-7H3,(H,22,23,26,27)/t15-,16+,18+/m0/s1 |
| InChIKey | YZQQDCYWYRIDLY-LZLYRXPVSA-N |
| XLogP | 3.22 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|