C19H33F2N3O7Si — CID 159836944
2-methoxyethyl N-[1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate;hydrofluoride (PubChem CID 159836944) has the molecular formula C19H33F2N3O7Si and a molecular weight of 481.57 g/mol. Its IUPAC name is 2-methoxyethyl N-[1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate;hydrofluoride.
| Compound Name | 2-methoxyethyl N-[1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate;hydrofluoride |
|---|---|
| PubChem CID | 159836944 |
| Molecular Formula | C19H33F2N3O7Si |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-methoxyethyl N-[1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate;hydrofluoride |
| SMILES | COCCOC(=O)Nc1ccn([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)C2F)c(=O)n1.F |
| InChI | InChI=1S/C19H32FN3O7Si.FH/c1-19(2,3)31(5,6)29-11-12-15(24)14(20)16(30-12)23-8-7-13(21-17(23)25)22-18(26)28-10-9-27-4;/h7-8,12,14-16,24H,9-11H2,1-6H3,(H,21,22,25,26);1H/t12-,14?,15-,16-;/m1./s1 |
| InChIKey | NOEVUNXWCFPIEF-DAUHPHDESA-N |
| XLogP | 2.21 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|