C13H16FN3O6 — CID 91452016
prop-2-enyl N-[1-[(2R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 91452016) has the molecular formula C13H16FN3O6 and a molecular weight of 329.28 g/mol. Its IUPAC name is prop-2-enyl N-[1-[(2R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | prop-2-enyl N-[1-[(2R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 91452016 |
| Molecular Formula | C13H16FN3O6 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | prop-2-enyl N-[1-[(2R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | C=CCOC(=O)Nc1ccn([C@@H]2O[C@H](CO)C(O)C2F)c(=O)n1 |
| InChI | InChI=1S/C13H16FN3O6/c1-2-5-22-13(21)16-8-3-4-17(12(20)15-8)11-9(14)10(19)7(6-18)23-11/h2-4,7,9-11,18-19H,1,5-6H2,(H,15,16,20,21)/t7-,9?,10?,11-/m1/s1 |
| InChIKey | BHMSGBGVRKNQMP-ZJTJHKMLSA-N |
| XLogP | -0.43 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|