C12H14F3N3O6 — CID 170902536
N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]-3,3,3-trifluoropropanamide (PubChem CID 170902536) has the molecular formula C12H14F3N3O6 and a molecular weight of 353.25 g/mol. Its IUPAC name is N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 170902536 |
| Molecular Formula | C12H14F3N3O6 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]-3,3,3-trifluoropropanamide |
| SMILES | O=C(CC(F)(F)F)Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C12H14F3N3O6/c13-12(14,15)3-7(20)16-6-1-2-18(11(23)17-6)10-9(22)8(21)5(4-19)24-10/h1-2,5,8-10,19,21-22H,3-4H2,(H,16,17,20,23)/t5-,8-,9-,10-/m1/s1 |
| InChIKey | NZHDVESZWODARW-UUOKUNOPSA-N |
| XLogP | -1.25 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |