C41H64N6O4Si3 — CID 101179332
9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-8-N-(9H-fluoren-2-yl)purine-6,8-diamine (PubChem CID 101179332) has the molecular formula C41H64N6O4Si3 and a molecular weight of 789.26 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-8-N-(9H-fluoren-2-yl)purine-6,8-diamine.
| Compound Name | 9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-8-N-(9H-fluoren-2-yl)purine-6,8-diamine |
|---|---|
| PubChem CID | 101179332 |
| Molecular Formula | C41H64N6O4Si3 |
| Molecular Weight | 789.26 g/mol |
| Exact Mass | 788.43 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-8-N-(9H-fluoren-2-yl)purine-6,8-diamine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2c(Nc3ccc4c(c3)Cc3ccccc3-4)nc3c(N)ncnc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C41H64N6O4Si3/c1-39(2,3)52(10,11)48-24-31-33(50-53(12,13)40(4,5)6)34(51-54(14,15)41(7,8)9)37(49-31)47-36-32(35(42)43-25-44-36)46-38(47)45-28-20-21-30-27(23-28)22-26-18-16-17-19-29(26)30/h16-21,23,25,31,33-34,37H,22,24H2,1-15H3,(H,45,46)(H2,42,43,44)/t31-,33-,34-,37-/m1/s1 |
| InChIKey | ADELITOUINFLOY-SPBWOXKUSA-N |
| XLogP | 10.42 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.26 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|