C35H50N6O4Si2 — CID 135516573
2-[(2-amino-9H-fluoren-3-yl)amino]-9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1H-purin-6-one (PubChem CID 135516573) has the molecular formula C35H50N6O4Si2 and a molecular weight of 675.00 g/mol. Its IUPAC name is 2-[(2-amino-9H-fluoren-3-yl)amino]-9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-[(2-amino-9H-fluoren-3-yl)amino]-9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135516573 |
| Molecular Formula | C35H50N6O4Si2 |
| Molecular Weight | 675.00 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | 2-[(2-amino-9H-fluoren-3-yl)amino]-9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1H-purin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(Nc4cc5c(cc4N)Cc4ccccc4-5)nc32)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H50N6O4Si2/c1-34(2,3)46(7,8)43-19-28-27(45-47(9,10)35(4,5)6)18-29(44-28)41-20-37-30-31(41)39-33(40-32(30)42)38-26-17-24-22(16-25(26)36)15-21-13-11-12-14-23(21)24/h11-14,16-17,20,27-29H,15,18-19,36H2,1-10H3,(H2,38,39,40,42)/t27-,28+,29+/m0/s1 |
| InChIKey | AMFVDZBZGYLKCC-ZGIBFIJWSA-N |
| XLogP | 7.72 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.00 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|