C10H13N5O3 — CID 10824622
6-amino-9-[(3S,5S)-5-(hydroxymethyl)oxolan-3-yl]-7H-purin-8-one (PubChem CID 10824622) has the molecular formula C10H13N5O3 and a molecular weight of 251.25 g/mol. Its IUPAC name is 6-amino-9-[(3S,5S)-5-(hydroxymethyl)oxolan-3-yl]-7H-purin-8-one.
| Compound Name | 6-amino-9-[(3S,5S)-5-(hydroxymethyl)oxolan-3-yl]-7H-purin-8-one |
|---|---|
| PubChem CID | 10824622 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 6-amino-9-[(3S,5S)-5-(hydroxymethyl)oxolan-3-yl]-7H-purin-8-one |
| SMILES | Nc1ncnc2c1[nH]c(=O)n2[C@@H]1CO[C@H](CO)C1 |
| InChI | InChI=1S/C10H13N5O3/c11-8-7-9(13-4-12-8)15(10(17)14-7)5-1-6(2-16)18-3-5/h4-6,16H,1-3H2,(H,14,17)(H2,11,12,13)/t5-,6-/m0/s1 |
| InChIKey | FYDXBYYYQJNTCW-WDSKDSINSA-N |
| XLogP | -0.98 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |