C15H22N6O3 — CID 86719295
tert-butyl (2S)-2-[(6-amino-8-oxo-7H-purin-9-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 86719295) has the molecular formula C15H22N6O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(6-amino-8-oxo-7H-purin-9-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(6-amino-8-oxo-7H-purin-9-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86719295 |
| Molecular Formula | C15H22N6O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | tert-butyl (2S)-2-[(6-amino-8-oxo-7H-purin-9-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1Cn1c(=O)[nH]c2c(N)ncnc21 |
| InChI | InChI=1S/C15H22N6O3/c1-15(2,3)24-14(23)20-6-4-5-9(20)7-21-12-10(19-13(21)22)11(16)17-8-18-12/h8-9H,4-7H2,1-3H3,(H,19,22)(H2,16,17,18)/t9-/m0/s1 |
| InChIKey | CBUCWKCIFSVKTR-VIFPVBQESA-N |
| XLogP | 1.10 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |