C10H12N8O2 — CID 121486826
[(2S,5R)-5-(6-amino-8-azidopurin-9-yl)oxolan-2-yl]methanol (PubChem CID 121486826) has the molecular formula C10H12N8O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is [(2S,5R)-5-(6-amino-8-azidopurin-9-yl)oxolan-2-yl]methanol.
| Compound Name | [(2S,5R)-5-(6-amino-8-azidopurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 121486826 |
| Molecular Formula | C10H12N8O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | [(2S,5R)-5-(6-amino-8-azidopurin-9-yl)oxolan-2-yl]methanol |
| SMILES | [N-]=[N+]=Nc1nc2c(N)ncnc2n1[C@H]1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C10H12N8O2/c11-8-7-9(14-4-13-8)18(10(15-7)16-17-12)6-2-1-5(3-19)20-6/h4-6,19H,1-3H2,(H2,11,13,14)/t5-,6+/m0/s1 |
| InChIKey | YNWIVPLDEUEIEY-NTSWFWBYSA-N |
| XLogP | 1.02 |
| TPSA | 147.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|