C10H13N5O3 — CID 136663246
8-amino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 136663246) has the molecular formula C10H13N5O3 and a molecular weight of 251.25 g/mol. Its IUPAC name is 8-amino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 8-amino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136663246 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 8-amino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(=O)[nH]cnc2n1[C@H]1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C10H13N5O3/c11-10-14-7-8(12-4-13-9(7)17)15(10)6-2-1-5(3-16)18-6/h4-6,16H,1-3H2,(H2,11,14)(H,12,13,17)/t5-,6+/m0/s1 |
| InChIKey | VVOVYKNWQKDEEI-NTSWFWBYSA-N |
| XLogP | -0.63 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |