C11H14N6O3 — CID 135703690
4-(hydroxymethyl)-8-methyl-3-oxa-1,7,8,10,13,15-hexazatetracyclo[7.7.0.02,6.011,16]hexadeca-9,11(16),14-trien-12-one (PubChem CID 135703690) has the molecular formula C11H14N6O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 4-(hydroxymethyl)-8-methyl-3-oxa-1,7,8,10,13,15-hexazatetracyclo[7.7.0.02,6.011,16]hexadeca-9,11(16),14-trien-12-one.
| Compound Name | 4-(hydroxymethyl)-8-methyl-3-oxa-1,7,8,10,13,15-hexazatetracyclo[7.7.0.02,6.011,16]hexadeca-9,11(16),14-trien-12-one |
|---|---|
| PubChem CID | 135703690 |
| Molecular Formula | C11H14N6O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4-(hydroxymethyl)-8-methyl-3-oxa-1,7,8,10,13,15-hexazatetracyclo[7.7.0.02,6.011,16]hexadeca-9,11(16),14-trien-12-one |
| SMILES | CN1NC2CC(CO)OC2n2c1nc1c(=O)[nH]cnc12 |
| InChI | InChI=1S/C11H14N6O3/c1-16-11-14-7-8(12-4-13-9(7)19)17(11)10-6(15-16)2-5(3-18)20-10/h4-6,10,15,18H,2-3H2,1H3,(H,12,13,19) |
| InChIKey | WMQODWKSSJPDSB-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |