C14H20N6O7 — CID 135483722
(2R)-2-amino-4-(hydroxyamino)-4-oxobutanoic acid;9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135483722) has the molecular formula C14H20N6O7 and a molecular weight of 384.35 g/mol. Its IUPAC name is (2R)-2-amino-4-(hydroxyamino)-4-oxobutanoic acid;9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | (2R)-2-amino-4-(hydroxyamino)-4-oxobutanoic acid;9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135483722 |
| Molecular Formula | C14H20N6O7 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | (2R)-2-amino-4-(hydroxyamino)-4-oxobutanoic acid;9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | N[C@H](CC(=O)NO)C(=O)O.O=c1[nH]cnc2c1ncn2[C@H]1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C10H12N4O3.C4H8N2O4/c15-3-6-1-2-7(17-6)14-5-13-8-9(14)11-4-12-10(8)16;5-2(4(8)9)1-3(7)6-10/h4-7,15H,1-3H2,(H,11,12,16);2,10H,1,5H2,(H,6,7)(H,8,9)/t6-,7+;2-/m01/s1 |
| InChIKey | NJDMZIGDVIHHFA-ZFKVISQJSA-N |
| XLogP | -1.92 |
| TPSA | 205.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|