C11H14FN5O2 — CID 14853632
[5-(6-amino-8-methylpurin-9-yl)-4-fluorooxolan-2-yl]methanol (PubChem CID 14853632) has the molecular formula C11H14FN5O2 and a molecular weight of 267.26 g/mol. Its IUPAC name is [5-(6-amino-8-methylpurin-9-yl)-4-fluorooxolan-2-yl]methanol.
| Compound Name | [5-(6-amino-8-methylpurin-9-yl)-4-fluorooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 14853632 |
| Molecular Formula | C11H14FN5O2 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | [5-(6-amino-8-methylpurin-9-yl)-4-fluorooxolan-2-yl]methanol |
| SMILES | Cc1nc2c(N)ncnc2n1C1OC(CO)CC1F |
| InChI | InChI=1S/C11H14FN5O2/c1-5-16-8-9(13)14-4-15-10(8)17(5)11-7(12)2-6(3-18)19-11/h4,6-7,11,18H,2-3H2,1H3,(H2,13,14,15) |
| InChIKey | QNGHOQJBOWPNPR-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |