C11H13N5O2 — CID 132942269
(1S,2R,5R)-5-(6-amino-8-methylpurin-9-yl)cyclopent-3-ene-1,2-diol (PubChem CID 132942269) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is (1S,2R,5R)-5-(6-amino-8-methylpurin-9-yl)cyclopent-3-ene-1,2-diol.
| Compound Name | (1S,2R,5R)-5-(6-amino-8-methylpurin-9-yl)cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 132942269 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | (1S,2R,5R)-5-(6-amino-8-methylpurin-9-yl)cyclopent-3-ene-1,2-diol |
| SMILES | Cc1nc2c(N)ncnc2n1[C@@H]1C=C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H13N5O2/c1-5-15-8-10(12)13-4-14-11(8)16(5)6-2-3-7(17)9(6)18/h2-4,6-7,9,17-18H,1H3,(H2,12,13,14)/t6-,7-,9+/m1/s1 |
| InChIKey | YXQUQNJLFDSFBE-BHNWBGBOSA-N |
| XLogP | -0.45 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|