C14H23N7O3 — CID 25233766
(2R,3R,4S,5R)-2-(6-amino-8-methylpurin-9-yl)-5-[[2-(methylamino)ethylamino]methyl]oxolane-3,4-diol (PubChem CID 25233766) has the molecular formula C14H23N7O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-8-methylpurin-9-yl)-5-[[2-(methylamino)ethylamino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-8-methylpurin-9-yl)-5-[[2-(methylamino)ethylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 25233766 |
| Molecular Formula | C14H23N7O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-8-methylpurin-9-yl)-5-[[2-(methylamino)ethylamino]methyl]oxolane-3,4-diol |
| SMILES | CNCCNC[C@H]1O[C@@H](n2c(C)nc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H23N7O3/c1-7-20-9-12(15)18-6-19-13(9)21(7)14-11(23)10(22)8(24-14)5-17-4-3-16-2/h6,8,10-11,14,16-17,22-23H,3-5H2,1-2H3,(H2,15,18,19)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | WOZXSUBFHZHWHJ-IDTAVKCVSA-N |
| XLogP | -1.85 |
| TPSA | 143.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|