C14H22N8O4 — CID 25183746
2-[[(2R,3S,4R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]acetohydrazide (PubChem CID 25183746) has the molecular formula C14H22N8O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]acetohydrazide.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]acetohydrazide |
|---|---|
| PubChem CID | 25183746 |
| Molecular Formula | C14H22N8O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]acetohydrazide |
| SMILES | Cc1nc2c(N)ncnc2n1[C@@H]1O[C@H](CN(C)CC(=O)NN)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H22N8O4/c1-6-19-9-12(15)17-5-18-13(9)22(6)14-11(25)10(24)7(26-14)3-21(2)4-8(23)20-16/h5,7,10-11,14,24-25H,3-4,16H2,1-2H3,(H,20,23)(H2,15,17,18)/t7-,10-,11-,14-/m1/s1 |
| InChIKey | UOTYBAWAEFLDES-FRJWGUMJSA-N |
| XLogP | -2.74 |
| TPSA | 177.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|