C21H31N7O8S — CID 44564195
(2R,3S,4R,5R)-2-[[4-aminooxybutyl(methyl)amino]methyl]-5-(6-amino-8-phenylpurin-9-yl)oxolane-3,4-diol;sulfuric acid (PubChem CID 44564195) has the molecular formula C21H31N7O8S and a molecular weight of 541.59 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[[4-aminooxybutyl(methyl)amino]methyl]-5-(6-amino-8-phenylpurin-9-yl)oxolane-3,4-diol;sulfuric acid.
| Compound Name | (2R,3S,4R,5R)-2-[[4-aminooxybutyl(methyl)amino]methyl]-5-(6-amino-8-phenylpurin-9-yl)oxolane-3,4-diol;sulfuric acid |
|---|---|
| PubChem CID | 44564195 |
| Molecular Formula | C21H31N7O8S |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | (2R,3S,4R,5R)-2-[[4-aminooxybutyl(methyl)amino]methyl]-5-(6-amino-8-phenylpurin-9-yl)oxolane-3,4-diol;sulfuric acid |
| SMILES | CN(CCCCON)C[C@H]1O[C@@H](n2c(-c3ccccc3)nc3c(N)ncnc32)[C@H](O)[C@@H]1O.O=S(=O)(O)O |
| InChI | InChI=1S/C21H29N7O4.H2O4S/c1-27(9-5-6-10-31-23)11-14-16(29)17(30)21(32-14)28-19(13-7-3-2-4-8-13)26-15-18(22)24-12-25-20(15)28;1-5(2,3)4/h2-4,7-8,12,14,16-17,21,29-30H,5-6,9-11,23H2,1H3,(H2,22,24,25);(H2,1,2,3,4)/t14-,16-,17-,21-;/m1./s1 |
| InChIKey | NAIUCAQNYCECJV-QQAZIOFSSA-N |
| XLogP | -0.36 |
| TPSA | 232.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|