C20H34N8O5 — CID 91077716
(2R,5R)-2-[6-amino-8-(methylamino)purin-9-yl]-5-[[4-(1-ethoxyethenylamino)oxybutyl-methylamino]methyl]oxolane-3,4-diol (PubChem CID 91077716) has the molecular formula C20H34N8O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is (2R,5R)-2-[6-amino-8-(methylamino)purin-9-yl]-5-[[4-(1-ethoxyethenylamino)oxybutyl-methylamino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-[6-amino-8-(methylamino)purin-9-yl]-5-[[4-(1-ethoxyethenylamino)oxybutyl-methylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 91077716 |
| Molecular Formula | C20H34N8O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | (2R,5R)-2-[6-amino-8-(methylamino)purin-9-yl]-5-[[4-(1-ethoxyethenylamino)oxybutyl-methylamino]methyl]oxolane-3,4-diol |
| SMILES | C=C(NOCCCCN(C)C[C@H]1O[C@@H](n2c(NC)nc3c(N)ncnc32)C(O)C1O)OCC |
| InChI | InChI=1S/C20H34N8O5/c1-5-31-12(2)26-32-9-7-6-8-27(4)10-13-15(29)16(30)19(33-13)28-18-14(25-20(28)22-3)17(21)23-11-24-18/h11,13,15-16,19,26,29-30H,2,5-10H2,1,3-4H3,(H,22,25)(H2,21,23,24)/t13-,15?,16?,19-/m1/s1 |
| InChIKey | VGEIAFMRUDFSNM-BECUHMJXSA-N |
| XLogP | -0.19 |
| TPSA | 165.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|