C19H31N7O6 — CID 87481696
6-amino-9-[(2R,3R,4S,5R)-5-[[4-(2-ethoxyethylideneamino)oxybutyl-methylamino]methyl]-3,4-dihydroxyoxolan-2-yl]-7H-purin-8-one (PubChem CID 87481696) has the molecular formula C19H31N7O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is 6-amino-9-[(2R,3R,4S,5R)-5-[[4-(2-ethoxyethylideneamino)oxybutyl-methylamino]methyl]-3,4-dihydroxyoxolan-2-yl]-7H-purin-8-one.
| Compound Name | 6-amino-9-[(2R,3R,4S,5R)-5-[[4-(2-ethoxyethylideneamino)oxybutyl-methylamino]methyl]-3,4-dihydroxyoxolan-2-yl]-7H-purin-8-one |
|---|---|
| PubChem CID | 87481696 |
| Molecular Formula | C19H31N7O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 6-amino-9-[(2R,3R,4S,5R)-5-[[4-(2-ethoxyethylideneamino)oxybutyl-methylamino]methyl]-3,4-dihydroxyoxolan-2-yl]-7H-purin-8-one |
| SMILES | CCOCC=NOCCCCN(C)C[C@H]1O[C@@H](n2c(=O)[nH]c3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H31N7O6/c1-3-30-9-6-23-31-8-5-4-7-25(2)10-12-14(27)15(28)18(32-12)26-17-13(24-19(26)29)16(20)21-11-22-17/h6,11-12,14-15,18,27-28H,3-5,7-10H2,1-2H3,(H,24,29)(H2,20,21,22)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | XDICQHJSBLVMCR-SCFUHWHPSA-N |
| XLogP | -0.93 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|