C18H30N7O8P — CID 11454892
(2S,3S)-2-amino-N-[[(2R,3S,4R,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-ethoxyphosphoryl]-3-methylpentanamide (PubChem CID 11454892) has the molecular formula C18H30N7O8P and a molecular weight of 503.45 g/mol. Its IUPAC name is (2S,3S)-2-amino-N-[[(2R,3S,4R,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-ethoxyphosphoryl]-3-methylpentanamide.
| Compound Name | (2S,3S)-2-amino-N-[[(2R,3S,4R,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-ethoxyphosphoryl]-3-methylpentanamide |
|---|---|
| PubChem CID | 11454892 |
| Molecular Formula | C18H30N7O8P |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (2S,3S)-2-amino-N-[[(2R,3S,4R,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-ethoxyphosphoryl]-3-methylpentanamide |
| SMILES | CCOP(=O)(NC(=O)[C@@H](N)[C@@H](C)CC)OC[C@H]1O[C@@H](n2c(=O)[nH]c3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H30N7O8P/c1-4-8(3)10(19)16(28)24-34(30,31-5-2)32-6-9-12(26)13(27)17(33-9)25-15-11(23-18(25)29)14(20)21-7-22-15/h7-10,12-13,17,26-27H,4-6,19H2,1-3H3,(H,23,29)(H2,20,21,22)(H,24,28,30)/t8-,9+,10-,12+,13+,17+,34?/m0/s1 |
| InChIKey | TUTPSLJLYTVUHT-NMBMGKNHSA-N |
| XLogP | -1.03 |
| TPSA | 229.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|