C30H35ClN7O9P — CID 145410611
benzyl (2S)-2-[[[(2R,3R,4S,5R)-5-(6-amino-8-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]amino]propanoate (PubChem CID 145410611) has the molecular formula C30H35ClN7O9P and a molecular weight of 704.08 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,3R,4S,5R)-5-(6-amino-8-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,3R,4S,5R)-5-(6-amino-8-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 145410611 |
| Molecular Formula | C30H35ClN7O9P |
| Molecular Weight | 704.08 g/mol |
| Exact Mass | 703.19 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,3R,4S,5R)-5-(6-amino-8-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(N[C@@H](C)C(=O)OCc1ccccc1)OC[C@H]1O[C@@H](n2c(Cl)nc3c(N)ncnc32)[C@@H](O)[C@H]1O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H35ClN7O9P/c1-17(28(41)44-13-19-9-5-3-6-10-19)36-48(43,37-18(2)29(42)45-14-20-11-7-4-8-12-20)46-15-21-23(39)24(40)27(47-21)38-26-22(35-30(38)31)25(32)33-16-34-26/h3-12,16-18,21,23-24,27,39-40H,13-15H2,1-2H3,(H2,32,33,34)(H2,36,37,43)/t17-,18-,21+,23-,24-,27+/m0/s1 |
| InChIKey | QAEDHXKYLATUDU-PYNNNHLFSA-N |
| XLogP | 2.25 |
| TPSA | 222.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.08 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|