C35H38ClN6O8P — CID 145410617
cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(6-amino-8-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]-3-phenylpropanoate (PubChem CID 145410617) has the molecular formula C35H38ClN6O8P and a molecular weight of 737.15 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(6-amino-8-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]-3-phenylpropanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(6-amino-8-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 145410617 |
| Molecular Formula | C35H38ClN6O8P |
| Molecular Weight | 737.15 g/mol |
| Exact Mass | 736.22 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(6-amino-8-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]-3-phenylpropanoate |
| SMILES | Nc1ncnc2c1nc(Cl)n2[C@@H]1O[C@H](COP(=O)(N[C@@H](Cc2ccccc2)C(=O)OC2CCCCC2)Oc2cccc3ccccc23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C35H38ClN6O8P/c36-35-40-28-31(37)38-20-39-32(28)42(35)33-30(44)29(43)27(49-33)19-47-51(46,50-26-17-9-13-22-12-7-8-16-24(22)26)41-25(18-21-10-3-1-4-11-21)34(45)48-23-14-5-2-6-15-23/h1,3-4,7-13,16-17,20,23,25,27,29-30,33,43-44H,2,5-6,14-15,18-19H2,(H,41,46)(H2,37,38,39)/t25-,27+,29-,30-,33+,51?/m0/s1 |
| InChIKey | ZPGLTAYLAOTZFD-ZUIVQHMLSA-N |
| XLogP | 5.11 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.15 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|