C25H26ClN6O8P — CID 153291017
benzyl 2-[[[(2R,4S,5R)-5-(6-amino-8-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate (PubChem CID 153291017) has the molecular formula C25H26ClN6O8P and a molecular weight of 604.94 g/mol. Its IUPAC name is benzyl 2-[[[(2R,4S,5R)-5-(6-amino-8-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate.
| Compound Name | benzyl 2-[[[(2R,4S,5R)-5-(6-amino-8-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 153291017 |
| Molecular Formula | C25H26ClN6O8P |
| Molecular Weight | 604.94 g/mol |
| Exact Mass | 604.12 |
| IUPAC Name | benzyl 2-[[[(2R,4S,5R)-5-(6-amino-8-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate |
| SMILES | Nc1ncnc2c1nc(Cl)n2[C@@H]1O[C@H](COP(=O)(NCC(=O)OCc2ccccc2)Oc2ccccc2)C(O)[C@@H]1O |
| InChI | InChI=1S/C25H26ClN6O8P/c26-25-31-19-22(27)28-14-29-23(19)32(25)24-21(35)20(34)17(39-24)13-38-41(36,40-16-9-5-2-6-10-16)30-11-18(33)37-12-15-7-3-1-4-8-15/h1-10,14,17,20-21,24,34-35H,11-13H2,(H,30,36)(H2,27,28,29)/t17-,20?,21+,24-,41?/m1/s1 |
| InChIKey | CDQQZZDARXMKLB-UWLZCJGWSA-N |
| XLogP | 2.22 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.94 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|