C14H21N6O8P — CID 11189657
N-[[(2R,3S,4R,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-ethoxyphosphoryl]acetamide (PubChem CID 11189657) has the molecular formula C14H21N6O8P and a molecular weight of 432.33 g/mol. Its IUPAC name is N-[[(2R,3S,4R,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-ethoxyphosphoryl]acetamide.
| Compound Name | N-[[(2R,3S,4R,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-ethoxyphosphoryl]acetamide |
|---|---|
| PubChem CID | 11189657 |
| Molecular Formula | C14H21N6O8P |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N-[[(2R,3S,4R,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-ethoxyphosphoryl]acetamide |
| SMILES | CCOP(=O)(NC(C)=O)OC[C@H]1O[C@@H](n2c(=O)[nH]c3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H21N6O8P/c1-3-26-29(25,19-6(2)21)27-4-7-9(22)10(23)13(28-7)20-12-8(18-14(20)24)11(15)16-5-17-12/h5,7,9-10,13,22-23H,3-4H2,1-2H3,(H,18,24)(H2,15,16,17)(H,19,21,25)/t7-,9-,10-,13-,29?/m1/s1 |
| InChIKey | YJLSVOBZRDSZAC-MQJQZHHKSA-N |
| XLogP | -1.38 |
| TPSA | 203.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|