C25H35N7O5 — CID 25183018
ethyl (1Z)-N-[4-[[(2R,3S,4R,5R)-5-(6-amino-8-phenylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]butoxy]ethanimidate (PubChem CID 25183018) has the molecular formula C25H35N7O5 and a molecular weight of 513.60 g/mol. Its IUPAC name is ethyl (1Z)-N-[4-[[(2R,3S,4R,5R)-5-(6-amino-8-phenylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]butoxy]ethanimidate.
| Compound Name | ethyl (1Z)-N-[4-[[(2R,3S,4R,5R)-5-(6-amino-8-phenylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]butoxy]ethanimidate |
|---|---|
| PubChem CID | 25183018 |
| Molecular Formula | C25H35N7O5 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | ethyl (1Z)-N-[4-[[(2R,3S,4R,5R)-5-(6-amino-8-phenylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]butoxy]ethanimidate |
| SMILES | CCO/C(C)=N\OCCCCN(C)C[C@H]1O[C@@H](n2c(-c3ccccc3)nc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H35N7O5/c1-4-35-16(2)30-36-13-9-8-12-31(3)14-18-20(33)21(34)25(37-18)32-23(17-10-6-5-7-11-17)29-19-22(26)27-15-28-24(19)32/h5-7,10-11,15,18,20-21,25,33-34H,4,8-9,12-14H2,1-3H3,(H2,26,27,28)/b30-16-/t18-,20-,21-,25-/m1/s1 |
| InChIKey | VONOJFKZNXUMLT-ISRGMZISSA-N |
| XLogP | 1.79 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|