C20H31N7O11S2 — CID 25233764
(2R,3R,4S,5R)-2-(6-amino-8-phenylpurin-9-yl)-5-[[3-(methylamino)propylamino]methyl]oxolane-3,4-diol;sulfuric acid (PubChem CID 25233764) has the molecular formula C20H31N7O11S2 and a molecular weight of 609.64 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-8-phenylpurin-9-yl)-5-[[3-(methylamino)propylamino]methyl]oxolane-3,4-diol;sulfuric acid.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-8-phenylpurin-9-yl)-5-[[3-(methylamino)propylamino]methyl]oxolane-3,4-diol;sulfuric acid |
|---|---|
| PubChem CID | 25233764 |
| Molecular Formula | C20H31N7O11S2 |
| Molecular Weight | 609.64 g/mol |
| Exact Mass | 609.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-8-phenylpurin-9-yl)-5-[[3-(methylamino)propylamino]methyl]oxolane-3,4-diol;sulfuric acid |
| SMILES | CNCCCNC[C@H]1O[C@@H](n2c(-c3ccccc3)nc3c(N)ncnc32)[C@H](O)[C@@H]1O.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C20H27N7O3.2H2O4S/c1-22-8-5-9-23-10-13-15(28)16(29)20(30-13)27-18(12-6-3-2-4-7-12)26-14-17(21)24-11-25-19(14)27;2*1-5(2,3)4/h2-4,6-7,11,13,15-16,20,22-23,28-29H,5,8-10H2,1H3,(H2,21,24,25);2*(H2,1,2,3,4)/t13-,15-,16-,20-;;/m1../s1 |
| InChIKey | WXMACOYPGPDPFA-LGLKDMIUSA-N |
| XLogP | -1.41 |
| TPSA | 292.57 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.64 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|