C15H25N7O4 — CID 25181594
(2R,3R,4S,5R)-2-(6-amino-8-methylpurin-9-yl)-5-[2-hydroxy-2-[2-(methylamino)ethylamino]ethyl]oxolane-3,4-diol (PubChem CID 25181594) has the molecular formula C15H25N7O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-8-methylpurin-9-yl)-5-[2-hydroxy-2-[2-(methylamino)ethylamino]ethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-8-methylpurin-9-yl)-5-[2-hydroxy-2-[2-(methylamino)ethylamino]ethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 25181594 |
| Molecular Formula | C15H25N7O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-8-methylpurin-9-yl)-5-[2-hydroxy-2-[2-(methylamino)ethylamino]ethyl]oxolane-3,4-diol |
| SMILES | CNCCNC(O)C[C@H]1O[C@@H](n2c(C)nc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H25N7O4/c1-7-21-10-13(16)19-6-20-14(10)22(7)15-12(25)11(24)8(26-15)5-9(23)18-4-3-17-2/h6,8-9,11-12,15,17-18,23-25H,3-5H2,1-2H3,(H2,16,19,20)/t8-,9?,11-,12-,15-/m1/s1 |
| InChIKey | GZJKKPCRQHWQLR-FPMMIGMHSA-N |
| XLogP | -2.15 |
| TPSA | 163.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|