C12H16N4O4 — CID 59070010
(3R,4S,5R)-2-(6,8-dimethylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 59070010) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is (3R,4S,5R)-2-(6,8-dimethylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-(6,8-dimethylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 59070010 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (3R,4S,5R)-2-(6,8-dimethylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1nc(C)n2C1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16N4O4/c1-5-8-11(14-4-13-5)16(6(2)15-8)12-10(19)9(18)7(3-17)20-12/h4,7,9-10,12,17-19H,3H2,1-2H3/t7-,9-,10-,12?/m1/s1 |
| InChIKey | KTYFGMIPRBUVEV-IYYKZFDCSA-N |
| XLogP | -0.95 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |