C14H20N4O3 — CID 59892763
(2R,5S)-2-(6,8-dimethylpurin-9-yl)-4-ethyl-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 59892763) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is (2R,5S)-2-(6,8-dimethylpurin-9-yl)-4-ethyl-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,5S)-2-(6,8-dimethylpurin-9-yl)-4-ethyl-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 59892763 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (2R,5S)-2-(6,8-dimethylpurin-9-yl)-4-ethyl-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | CCC1C(O)[C@H](n2c(C)nc3c(C)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C14H20N4O3/c1-4-9-10(5-19)21-14(12(9)20)18-8(3)17-11-7(2)15-6-16-13(11)18/h6,9-10,12,14,19-20H,4-5H2,1-3H3/t9?,10-,12?,14-/m1/s1 |
| InChIKey | HMWZKIPZIMOTFW-DZRBHHQJSA-N |
| XLogP | 0.72 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |