C15H23N5O4S — CID 54153923
(2R,3R,4S,5R)-2-[6-(butylamino)-8-methylsulfanylpurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 54153923) has the molecular formula C15H23N5O4S and a molecular weight of 369.45 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(butylamino)-8-methylsulfanylpurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(butylamino)-8-methylsulfanylpurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 54153923 |
| Molecular Formula | C15H23N5O4S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(butylamino)-8-methylsulfanylpurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCCCNc1ncnc2c1nc(SC)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H23N5O4S/c1-3-4-5-16-12-9-13(18-7-17-12)20(15(19-9)25-2)14-11(23)10(22)8(6-21)24-14/h7-8,10-11,14,21-23H,3-6H2,1-2H3,(H,16,17,18)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | OJSGKCPURMNIQN-IDTAVKCVSA-N |
| XLogP | 0.37 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|