C14H20BrN5O4 — CID 57028284
(2R,3R,4S,5R)-2-[8-bromo-6-(butylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 57028284) has the molecular formula C14H20BrN5O4 and a molecular weight of 402.25 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[8-bromo-6-(butylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[8-bromo-6-(butylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57028284 |
| Molecular Formula | C14H20BrN5O4 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | (2R,3R,4S,5R)-2-[8-bromo-6-(butylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCCCNc1ncnc2c1nc(Br)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H20BrN5O4/c1-2-3-4-16-11-8-12(18-6-17-11)20(14(15)19-8)13-10(23)9(22)7(5-21)24-13/h6-7,9-10,13,21-23H,2-5H2,1H3,(H,16,17,18)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | JWSIKSWRMKAUAL-QYVSTXNMSA-N |
| XLogP | 0.41 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|