C10H11Br2N5O3 — CID 57131100
(2R,5R)-5-(6-amino-8-bromopurin-9-yl)-4-bromo-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 57131100) has the molecular formula C10H11Br2N5O3 and a molecular weight of 409.04 g/mol. Its IUPAC name is (2R,5R)-5-(6-amino-8-bromopurin-9-yl)-4-bromo-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,5R)-5-(6-amino-8-bromopurin-9-yl)-4-bromo-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 57131100 |
| Molecular Formula | C10H11Br2N5O3 |
| Molecular Weight | 409.04 g/mol |
| Exact Mass | 406.92 |
| IUPAC Name | (2R,5R)-5-(6-amino-8-bromopurin-9-yl)-4-bromo-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c1nc(Br)n2[C@@H]1O[C@H](CO)C(O)C1Br |
| InChI | InChI=1S/C10H11Br2N5O3/c11-4-6(19)3(1-18)20-9(4)17-8-5(16-10(17)12)7(13)14-2-15-8/h2-4,6,9,18-19H,1H2,(H2,13,14,15)/t3-,4?,6?,9-/m1/s1 |
| InChIKey | JJRFSFLZYDPGCO-CXIWTZSBSA-N |
| XLogP | 0.19 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.04 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|