C14H21BrN5O3P — CID 158727098
(3R,4S,5R)-2-(6-amino-8-bromopurin-9-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol (PubChem CID 158727098) has the molecular formula C14H21BrN5O3P and a molecular weight of 418.23 g/mol. Its IUPAC name is (3R,4S,5R)-2-(6-amino-8-bromopurin-9-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-(6-amino-8-bromopurin-9-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 158727098 |
| Molecular Formula | C14H21BrN5O3P |
| Molecular Weight | 418.23 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | (3R,4S,5R)-2-(6-amino-8-bromopurin-9-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol |
| SMILES | C=P(C)(C)CC[C@H]1OC(n2c(Br)nc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H21BrN5O3P/c1-24(2,3)5-4-7-9(21)10(22)13(23-7)20-12-8(19-14(20)15)11(16)17-6-18-12/h6-7,9-10,13,21-22H,1,4-5H2,2-3H3,(H2,16,17,18)/t7-,9-,10-,13?/m1/s1 |
| InChIKey | IUIDZPSBTSTKIR-RJNFYWFKSA-N |
| XLogP | 0.89 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|